2014-05-12 17:15:49 +02:00
|
|
|
function [x,FVAL,EXITFLAG,OUTPUT,JACOB] = lmmcp(FUN,x,lb,ub,options,varargin)
|
|
|
|
% LMMCP solves a mixed complementarity problem.
|
|
|
|
%
|
|
|
|
% LMMCP uses a semismooth least squares formulation. The method applies a
|
|
|
|
% Levenberg-Marquardt/Gauss-Newton algorithm to a least-squares formulation.
|
|
|
|
%
|
|
|
|
% X = LMMCP(FUN,X0) tries to solve the system of nonlinear equations F(X)=0 and
|
|
|
|
% starts at the vector X0. FUN accepts a vector X and return a vector F of equation
|
|
|
|
% values F evaluated at X and, as second output if required, a matrix J, the
|
|
|
|
% Jacobian evaluated at X.
|
|
|
|
%
|
|
|
|
% X = LMMCP(FUN,X0,LB,UB) solves the mixed complementarity problem of the form:
|
|
|
|
% LB =X => F(X)>0,
|
|
|
|
% LB<=X<=UB => F(X)=0,
|
|
|
|
% X =UB => F(X)<0.
|
|
|
|
%
|
|
|
|
% X = LMMCP(FUN,X0,LB,UB,OPTIONS) solves the MCP problem using the options
|
|
|
|
% defined in the structure OPTIONS. Main fields are
|
|
|
|
% Display : control the display of iterations, 'none' (default),
|
|
|
|
% 'iter-detailed' or 'final-detailed'
|
|
|
|
% Switch from phase I to phase II
|
|
|
|
% preprocess : activate preprocessor for phase I (default = 1)
|
|
|
|
% presteps : number of iterations in phase I (default = 20)
|
|
|
|
% Termination parameters
|
2014-05-18 21:49:16 +02:00
|
|
|
% MaxIter : Maximum number of iterations (default = 500)
|
2014-05-12 17:15:49 +02:00
|
|
|
% tmin : safeguard stepsize (default = 1E-12)
|
2014-05-18 21:49:16 +02:00
|
|
|
% TolFun : Termination tolerance on the function value, a positive
|
|
|
|
% scalar (default = sqrt(eps))
|
2014-05-12 17:15:49 +02:00
|
|
|
% Stepsize parameters
|
|
|
|
% m : number of previous function values to use in the nonmonotone
|
|
|
|
% line search rule (default = 10)
|
|
|
|
% kwatch : maximum number of steps (default = 20 and should not be
|
|
|
|
% smaller than m)
|
|
|
|
% watchdog : activate the watchdog strategy (default = 1)
|
|
|
|
% Ther are other minor parameters. Please see the code for their default values
|
|
|
|
% and interpretation.
|
|
|
|
%
|
|
|
|
% [X,FVAL] = LMMCP(FUN,X0,...) returns the value of the equations FUN at X.
|
|
|
|
%
|
|
|
|
% [X,FVAL,EXITFLAG] = LMMCP(FUN,X0,...) returns EXITFLAG that describes the exit
|
|
|
|
% conditions. Possible values are
|
|
|
|
% 1 : LMMCP converged to a root
|
|
|
|
% 0 : Too many iterations
|
|
|
|
% -1 :
|
|
|
|
%
|
|
|
|
% [X,FVAL,EXITFLAG,OUTPUT] = LMMCP(FUN,X0,...) returns the structure OUTPUT that
|
|
|
|
% contains the number of iterations (OUTPUT.iterations), the value of the merit
|
|
|
|
% function (OUTPUT.Psix), and the norm of the derivative of the merit function
|
|
|
|
% (OUTPUT.normDPsix).
|
|
|
|
%
|
|
|
|
% [X,FVAL,EXITFLAG,OUTPUT,JACOB] = LMMCP(FUN,X0,...) returns JACOB the Jacobian
|
|
|
|
% of FUN evaluated at X.
|
|
|
|
%
|
|
|
|
% More details of the main program may be found in the following paper:
|
|
|
|
%
|
|
|
|
% Christian Kanzow and Stefania Petra: On a semismooth least squares formulation of
|
|
|
|
% complementarity problems with gap reduction. Optimization Methods and Software
|
|
|
|
% 19, 2004, pp. 507-525.
|
|
|
|
%
|
|
|
|
% In addition, the current implementation uses a preprocessor which is the
|
|
|
|
% projected Levenberg-Marquardt step from the following preprint:
|
|
|
|
%
|
|
|
|
% Christian Kanzow and Stefania Petra: Projected filter trust region methods for a
|
|
|
|
% semismooth least squares formulation of mixed complementarity
|
|
|
|
% problems. Optimization Methods and Software
|
|
|
|
% 22, 2007, pp. 713-735.
|
|
|
|
%
|
|
|
|
% A user's guide is also available:
|
|
|
|
%
|
|
|
|
% Christian Kanzow and Stefania Petra (2005).
|
|
|
|
% LMMCP --- A Levenberg-Marquardt-type MATLAB Solver for Mixed Complementarity Problems.
|
|
|
|
% University of Wuerzburg.
|
|
|
|
% http://www.mathematik.uni-wuerzburg.de/~kanzow/software/UserGuide.pdf
|
|
|
|
%
|
|
|
|
% This is a modification by Christophe Gouel of the original files, which can be
|
|
|
|
% downloaded from:
|
|
|
|
% http://www.mathematik.uni-wuerzburg.de/~kanzow/software/LMMCP.zip
|
|
|
|
%
|
2014-07-10 14:24:41 +02:00
|
|
|
% Written by Christian Kanzow and Stefania Petra
|
2014-05-12 17:15:49 +02:00
|
|
|
% Institute of Applied Mathematics and Statistics
|
|
|
|
% University of Wuerzburg
|
|
|
|
% Am Hubland
|
|
|
|
% 97074 Wuerzburg
|
|
|
|
% GERMANY
|
|
|
|
%
|
|
|
|
% e-mail: kanzow@mathematik.uni-wuerzburg.de
|
|
|
|
% petra@mathematik.uni-wuerzburg.de
|
2014-07-10 14:24:41 +02:00
|
|
|
%
|
|
|
|
% Christian Kanzow sent a private message to Dynare Team on July 8, 2014,
|
|
|
|
% confirming the free software status of lmmcp and granting unlimited
|
|
|
|
% permission to use, copy, modifiy or redistribute the file.
|
|
|
|
|
|
|
|
% Copyright (C) 2005 Christian Kanzow and Stefania Petra
|
|
|
|
% Copyright (C) 2013 Christophe Gouel
|
|
|
|
% Copyright (C) 2014 Dynare Team
|
|
|
|
%
|
|
|
|
% Unlimited permission is granted to everyone to use, copy, modify or
|
|
|
|
% distribute this software.
|
2014-05-12 17:15:49 +02:00
|
|
|
|
2014-05-18 21:49:16 +02:00
|
|
|
%% Initialization
|
2014-05-12 17:15:49 +02:00
|
|
|
defaultopt = struct(...
|
|
|
|
'beta', 0.55,...
|
|
|
|
'Big', 1e10,...
|
|
|
|
'delta', 5,...
|
|
|
|
'deltamin', 1,...
|
|
|
|
'Display', 'none',...
|
|
|
|
'epsilon1', 1e-6,...
|
|
|
|
'eta', 0.95,...
|
|
|
|
'kwatch', 20,...
|
|
|
|
'lambda1', 0.1,...
|
|
|
|
'm', 10,...
|
|
|
|
'MaxIter', 500,...
|
|
|
|
'null', 1e-10,...
|
|
|
|
'preprocess', 1,...
|
|
|
|
'presteps', 20,...
|
|
|
|
'sigma', 1e-4,...
|
|
|
|
'sigma1', 0.5,...
|
|
|
|
'sigma2', 2,...
|
|
|
|
'tmin', 1e-12,...
|
2014-05-18 21:49:16 +02:00
|
|
|
'TolFun', sqrt(eps),...
|
2014-05-12 17:15:49 +02:00
|
|
|
'watchdog', 1);
|
|
|
|
|
|
|
|
if nargin < 4
|
|
|
|
ub = inf(size(x));
|
|
|
|
if nargin < 3
|
|
|
|
lb = -inf(size(x));
|
|
|
|
end
|
|
|
|
end
|
|
|
|
|
|
|
|
if nargin < 5 || isempty(options) || ~isstruct(options)
|
|
|
|
options = defaultopt;
|
|
|
|
else
|
|
|
|
warning('off','catstruct:DuplicatesFound')
|
|
|
|
options = catstruct(defaultopt,options);
|
|
|
|
end
|
|
|
|
|
2014-05-18 21:49:16 +02:00
|
|
|
warning('off','MATLAB:rankDeficientMatrix')
|
2014-05-12 17:15:49 +02:00
|
|
|
|
|
|
|
switch options.Display
|
2014-05-18 21:49:16 +02:00
|
|
|
case {'off','none'}
|
|
|
|
verbosity = 0;
|
|
|
|
case {'iter','iter-detailed'}
|
|
|
|
verbosity = 2;
|
|
|
|
case {'final','final-detailed'}
|
|
|
|
verbosity = 1;
|
|
|
|
otherwise
|
|
|
|
verbosity = 0;
|
2014-05-12 17:15:49 +02:00
|
|
|
end
|
|
|
|
|
|
|
|
% parameter settings
|
|
|
|
eps1 = options.epsilon1;
|
2014-05-18 21:49:16 +02:00
|
|
|
eps2 = 0.5*options.TolFun^2;
|
2014-05-12 17:15:49 +02:00
|
|
|
null = options.null;
|
|
|
|
Big = options.Big;
|
|
|
|
|
|
|
|
% maximal number of iterations
|
|
|
|
kmax = options.MaxIter;
|
|
|
|
|
|
|
|
% choice of lambda
|
|
|
|
lambda1 = options.lambda1;
|
|
|
|
lambda2 = 1-lambda1;
|
|
|
|
|
|
|
|
% steplength parameters
|
|
|
|
beta = options.beta;
|
|
|
|
sigma = options.sigma;
|
|
|
|
tmin = options.tmin;
|
|
|
|
|
|
|
|
% parameters watchdog and nonmonotone line search; redefined later
|
|
|
|
m = options.m;
|
|
|
|
kwatch = options.kwatch;
|
|
|
|
watchdog = options.watchdog; % 1=watchdog strategy active, otherwise not
|
|
|
|
|
|
|
|
% parameters for preprocessor
|
|
|
|
preprocess = options.preprocess; % 1=preprocessor used, otherwise not
|
|
|
|
presteps = options.presteps; % maximum number of preprocessing steps
|
|
|
|
|
|
|
|
% trust-region parameters for preprocessor
|
|
|
|
delta = options.delta;
|
|
|
|
deltamin = options.deltamin;
|
|
|
|
sigma1 = options.sigma1;
|
|
|
|
sigma2 = options.sigma2;
|
|
|
|
eta = options.eta;
|
|
|
|
|
|
|
|
% initializations
|
|
|
|
k = 0;
|
|
|
|
k_main = 0;
|
|
|
|
|
|
|
|
% compute a feasible starting point by projection
|
|
|
|
x = max(lb,min(x,ub));
|
|
|
|
|
|
|
|
n = length(x);
|
|
|
|
OUTPUT.Dim = n;
|
|
|
|
|
|
|
|
% definition of index sets I_l, I_u and I_lu
|
|
|
|
Indexset = zeros(n,1);
|
|
|
|
I_l = lb>-Big & ub>Big;
|
|
|
|
I_u = lb<-Big & ub<Big;
|
|
|
|
I_lu = lb>-Big & ub<Big;
|
|
|
|
Indexset(I_l) = 1;
|
|
|
|
Indexset(I_u) = 2;
|
|
|
|
Indexset(I_lu) = 3;
|
|
|
|
|
|
|
|
% function evaluations
|
|
|
|
[Fx,DFx] = feval(FUN,x,varargin{:});
|
|
|
|
|
|
|
|
% choice of NCP-function and corresponding evaluations
|
|
|
|
Phix = Phi(x,Fx,lb,ub,lambda1,lambda2,n,Indexset);
|
|
|
|
normPhix = norm(Phix);
|
|
|
|
Psix = 0.5*(Phix'*Phix);
|
|
|
|
DPhix = DPhi(x,Fx,DFx,lb,ub,lambda1,lambda2,n,Indexset);
|
|
|
|
DPsix = DPhix'*Phix;
|
|
|
|
normDPsix = norm(DPsix);
|
|
|
|
|
|
|
|
% save initial values
|
|
|
|
x0 = x;
|
|
|
|
Phix0 = Phix;
|
|
|
|
Psix0 = Psix;
|
|
|
|
DPhix0 = DPhix;
|
|
|
|
DPsix0 = DPsix;
|
|
|
|
normDPsix0 = normDPsix;
|
|
|
|
|
|
|
|
% watchdog strategy
|
|
|
|
aux = zeros(m,1);
|
|
|
|
aux(1) = Psix;
|
|
|
|
MaxPsi = Psix;
|
|
|
|
|
|
|
|
if watchdog==1
|
2014-05-18 21:49:16 +02:00
|
|
|
kbest = k;
|
|
|
|
xbest = x;
|
|
|
|
Phibest = Phix;
|
|
|
|
Psibest = Psix;
|
|
|
|
DPhibest = DPhix;
|
|
|
|
DPsibest = DPsix;
|
|
|
|
normDPsibest = normDPsix;
|
|
|
|
end
|
2014-05-12 17:15:49 +02:00
|
|
|
|
|
|
|
% initial output
|
|
|
|
if verbosity > 1
|
|
|
|
fprintf(' k Psi(x) || DPsi(x) || stepsize\n');
|
|
|
|
disp('====================================================================')
|
|
|
|
disp('********************* Output at starting point *********************')
|
|
|
|
fprintf('%4.0f %24.5e %24.5e\n',k,Psix,normDPsix);
|
|
|
|
end
|
|
|
|
|
2014-05-18 21:49:16 +02:00
|
|
|
%% Preprocessor using local method
|
2014-05-12 17:15:49 +02:00
|
|
|
|
|
|
|
if preprocess==1
|
|
|
|
|
|
|
|
if verbosity > 1
|
|
|
|
disp('************************** Preprocessor ****************************')
|
|
|
|
end
|
2014-05-18 21:49:16 +02:00
|
|
|
|
|
|
|
normpLM=1;
|
|
|
|
while (k < presteps) && (Psix > eps2) && (normpLM>null)
|
|
|
|
k = k+1;
|
|
|
|
|
|
|
|
% choice of Levenberg-Marquardt parameter, note that we do not use
|
|
|
|
% the condition estimator for large-scale problems, although this
|
|
|
|
% may cause numerical problems in some examples
|
|
|
|
|
|
|
|
i = false;
|
|
|
|
mu = 0;
|
|
|
|
if n<100
|
|
|
|
i = true;
|
|
|
|
mu = 1e-16;
|
|
|
|
if condest(DPhix'*DPhix)>1e25
|
|
|
|
mu = 1e-6/(k+1);
|
2014-05-12 17:15:49 +02:00
|
|
|
end
|
2014-05-18 21:49:16 +02:00
|
|
|
end
|
|
|
|
if i
|
|
|
|
pLM = [DPhix; sqrt(mu)*speye(n)]\[-Phix; zeros(n,1)];
|
|
|
|
else
|
|
|
|
pLM = -DPhix\Phix;
|
|
|
|
end
|
|
|
|
normpLM = norm(pLM);
|
|
|
|
|
|
|
|
% compute the projected Levenberg-Marquard step onto box Xk
|
|
|
|
lbnew = max(min(lb-x,0),-delta);
|
|
|
|
ubnew = min(max(ub-x,0),delta);
|
|
|
|
d = max(lbnew,min(pLM,ubnew));
|
|
|
|
xnew = x+d;
|
|
|
|
|
|
|
|
% function evaluations etc.
|
|
|
|
[Fxnew,DFxnew] = feval(FUN,xnew,varargin{:});
|
|
|
|
Phixnew = Phi(xnew,Fxnew,lb,ub,lambda1,lambda2,n,Indexset);
|
|
|
|
Psixnew = 0.5*(Phixnew'*Phixnew);
|
|
|
|
normPhixnew = norm(Phixnew);
|
|
|
|
|
|
|
|
% update of delta
|
|
|
|
if normPhixnew<=eta*normPhix
|
|
|
|
delta = max(deltamin,sigma2*delta);
|
|
|
|
elseif normPhixnew>5*eta*normPhix
|
|
|
|
delta = max(deltamin,sigma1*delta);
|
|
|
|
end
|
|
|
|
|
|
|
|
% update
|
|
|
|
x = xnew;
|
|
|
|
Fx = Fxnew;
|
|
|
|
DFx = DFxnew;
|
|
|
|
Phix = Phixnew;
|
|
|
|
Psix = Psixnew;
|
|
|
|
normPhix = normPhixnew;
|
|
|
|
DPhix = DPhi(x,Fx,DFx,lb,ub,lambda1,lambda2,n,Indexset);
|
|
|
|
DPsix = DPhix'*Phix;
|
|
|
|
normDPsix = norm(DPsix,inf);
|
|
|
|
|
|
|
|
% output at each iteration
|
|
|
|
t=1;
|
|
|
|
if verbosity > 1
|
|
|
|
fprintf('%4.0f %24.5e %24.5e %11.7g\n',k,Psix,normDPsix,t);
|
|
|
|
end
|
|
|
|
end
|
2014-05-12 17:15:49 +02:00
|
|
|
end
|
|
|
|
|
|
|
|
% terminate program or redefine current iterate as original initial point
|
|
|
|
if preprocess==1 && Psix<eps2
|
|
|
|
if verbosity > 0
|
|
|
|
fprintf('Psix = %1.4e\nnormDPsix = %1.4e\n',Psix,normDPsix);
|
|
|
|
disp('Approximate solution found.')
|
|
|
|
end
|
|
|
|
EXITFLAG = 1;
|
|
|
|
FVAL = Fx;
|
|
|
|
OUTPUT.iterations = k;
|
|
|
|
OUTPUT.Psix = Psix;
|
|
|
|
OUTPUT.normDPsix = normDPsix;
|
|
|
|
JACOB = DFx;
|
|
|
|
return
|
|
|
|
elseif preprocess==1 && Psix>=eps2
|
|
|
|
x=x0;
|
|
|
|
Phix=Phix0;
|
|
|
|
Psix=Psix0;
|
|
|
|
DPhix=DPhix0;
|
|
|
|
DPsix=DPsix0;
|
|
|
|
if verbosity > 1
|
|
|
|
disp('******************** Restart with initial point ********************')
|
|
|
|
fprintf('%4.0f %24.5e %24.5e\n',k_main,Psix0,normDPsix0);
|
2014-05-18 21:49:16 +02:00
|
|
|
end
|
2014-05-12 17:15:49 +02:00
|
|
|
end
|
|
|
|
|
2014-05-18 21:49:16 +02:00
|
|
|
%% Main algorithm
|
2014-05-12 17:15:49 +02:00
|
|
|
|
|
|
|
if verbosity > 1
|
|
|
|
disp('************************** Main program ****************************')
|
|
|
|
end
|
|
|
|
|
|
|
|
while (k < kmax) && (Psix > eps2)
|
|
|
|
|
2014-05-18 21:49:16 +02:00
|
|
|
% choice of Levenberg-Marquardt parameter, note that we do not use
|
|
|
|
% the condition estimator for large-scale problems, although this
|
|
|
|
% may cause numerical problems in some examples
|
|
|
|
|
|
|
|
i = false;
|
|
|
|
if n<100
|
|
|
|
i = true;
|
|
|
|
mu = 1e-16;
|
|
|
|
if condest(DPhix'*DPhix)>1e25
|
|
|
|
mu = 1e-1/(k+1);
|
|
|
|
end
|
|
|
|
end
|
|
|
|
|
|
|
|
% compute a Levenberg-Marquard direction
|
|
|
|
|
|
|
|
if i
|
|
|
|
d = [DPhix; sqrt(mu)*speye(n)]\[-Phix; zeros(n,1)];
|
|
|
|
else
|
|
|
|
d = -DPhix\Phix;
|
|
|
|
end
|
2014-05-12 17:15:49 +02:00
|
|
|
|
2014-05-18 21:49:16 +02:00
|
|
|
% computation of steplength t using the nonmonotone Armijo-rule
|
|
|
|
% starting with the 6-th iteration
|
|
|
|
|
|
|
|
% computation of steplength t using the monotone Armijo-rule if
|
|
|
|
% d is a 'good' descent direction or k<=5
|
|
|
|
|
|
|
|
t = 1;
|
|
|
|
xnew = x+d;
|
|
|
|
Fxnew = feval(FUN,xnew,varargin{:});
|
|
|
|
Phixnew = Phi(xnew,Fxnew,lb,ub,lambda1,lambda2,n,Indexset);
|
|
|
|
Psixnew = 0.5*(Phixnew'*Phixnew);
|
|
|
|
const = sigma*DPsix'*d;
|
|
|
|
|
|
|
|
while (Psixnew > MaxPsi + const*t) && (t > tmin)
|
|
|
|
t = t*beta;
|
|
|
|
xnew = x+t*d;
|
|
|
|
Fxnew = feval(FUN,xnew,varargin{:});
|
|
|
|
Phixnew = Phi(xnew,Fxnew,lb,ub,lambda1,lambda2,n,Indexset);
|
|
|
|
Psixnew = 0.5*(Phixnew'*Phixnew);
|
|
|
|
end
|
|
|
|
|
|
|
|
% updatings
|
|
|
|
x = xnew;
|
|
|
|
Fx = Fxnew;
|
|
|
|
Phix = Phixnew;
|
|
|
|
Psix = Psixnew;
|
2015-04-22 16:45:15 +02:00
|
|
|
[junk,DFx] = feval(FUN,x,varargin{:});
|
2014-05-18 21:49:16 +02:00
|
|
|
DPhix = DPhi(x,Fx,DFx,lb,ub,lambda1,lambda2,n,Indexset);
|
|
|
|
DPsix = DPhix'*Phix;
|
|
|
|
normDPsix = norm(DPsix);
|
|
|
|
k = k+1;
|
|
|
|
k_main = k_main+1;
|
|
|
|
|
|
|
|
if k_main<=5
|
|
|
|
aux(mod(k_main,m)+1) = Psix;
|
|
|
|
MaxPsi = Psix;
|
|
|
|
else
|
|
|
|
aux(mod(k_main,m)+1) = Psix;
|
|
|
|
MaxPsi = max(aux);
|
|
|
|
end
|
|
|
|
|
|
|
|
% updatings for the watchdog strategy
|
|
|
|
if watchdog ==1
|
|
|
|
if Psix<Psibest
|
|
|
|
kbest = k;
|
|
|
|
xbest = x;
|
|
|
|
Phibest = Phix;
|
|
|
|
Psibest = Psix;
|
|
|
|
DPhibest = DPhix;
|
|
|
|
DPsibest = DPsix;
|
|
|
|
normDPsibest = normDPsix;
|
|
|
|
elseif k-kbest>kwatch
|
|
|
|
x=xbest;
|
|
|
|
Phix=Phibest;
|
|
|
|
Psix=Psibest;
|
|
|
|
DPhix=DPhibest;
|
|
|
|
DPsix=DPsibest;
|
|
|
|
normDPsix=normDPsibest;
|
2014-05-12 17:15:49 +02:00
|
|
|
MaxPsi=Psix;
|
2014-05-18 21:49:16 +02:00
|
|
|
end
|
|
|
|
end
|
|
|
|
|
|
|
|
if verbosity > 1
|
|
|
|
% output at each iteration
|
|
|
|
fprintf('%4.0f %24.5e %24.5e %11.7g\n',k,Psix,normDPsix,t);
|
|
|
|
end
|
|
|
|
end
|
|
|
|
|
|
|
|
%% Final output
|
2014-05-12 17:15:49 +02:00
|
|
|
if Psix<=eps2
|
|
|
|
EXITFLAG = 1;
|
|
|
|
if verbosity > 0, disp('Approximate solution found.'); end
|
|
|
|
elseif k>=kmax
|
|
|
|
EXITFLAG = 0;
|
|
|
|
if verbosity > 0, disp('Maximum iteration number reached.'); end
|
|
|
|
elseif normDPsix<=eps1
|
|
|
|
EXITFLAG = -1; % Provisoire
|
|
|
|
if verbosity > 0, disp('Approximate stationary point found.'); end
|
|
|
|
else
|
|
|
|
EXITFLAG = -1; % Provisoire
|
|
|
|
if verbosity > 0, disp('No solution found.'); end
|
|
|
|
end
|
|
|
|
|
|
|
|
FVAL = Fx;
|
|
|
|
OUTPUT.iterations = k;
|
|
|
|
OUTPUT.Psix = Psix;
|
|
|
|
OUTPUT.normDPsix = normDPsix;
|
|
|
|
JACOB = DFx;
|
|
|
|
|
2014-05-18 21:49:16 +02:00
|
|
|
%% Subfunctions
|
2014-05-12 17:15:49 +02:00
|
|
|
|
|
|
|
function y = Phi(x,Fx,lb,ub,lambda1,lambda2,n,Indexset)
|
2014-05-18 21:49:16 +02:00
|
|
|
%% PHI
|
2014-05-12 17:15:49 +02:00
|
|
|
|
|
|
|
y = zeros(2*n,1);
|
|
|
|
phi_u = sqrt((ub-x).^2+Fx.^2)-ub+x+Fx;
|
|
|
|
LZ = false(n,1); % logical zero
|
|
|
|
|
|
|
|
I0 = Indexset==0;
|
|
|
|
y(I0) = -lambda1*Fx(I0);
|
|
|
|
y([LZ; I0]) = -lambda2*Fx(I0);
|
|
|
|
|
|
|
|
I1 = Indexset==1;
|
|
|
|
y(I1) = lambda1*(-x(I1)+lb(I1)-Fx(I1)+sqrt((x(I1)-lb(I1)).^2+Fx(I1).^2));
|
|
|
|
y([LZ; I1]) = lambda2*max(0,x(I1)-lb(I1)).*max(0,Fx(I1));
|
|
|
|
|
|
|
|
I2 = Indexset==2;
|
|
|
|
y(I2) = -lambda1*phi_u(I2);
|
|
|
|
y([LZ; I2]) = lambda2*max(0,ub(I2)-x(I2)).*max(0,-Fx(I2));
|
|
|
|
|
|
|
|
I3 = Indexset==3;
|
|
|
|
y(I3) = lambda1*(sqrt((x(I3)-lb(I3)).^2+phi_u(I3).^2)-x(I3)+lb(I3)-phi_u(I3));
|
|
|
|
y([LZ; I3]) = lambda2*(max(0,x(I3)-lb(I3)).*max(0,Fx(I3))+max(0,ub(I3)-x(I3)).*max(0,-Fx(I3)));
|
|
|
|
|
|
|
|
|
|
|
|
function H = DPhi(x,Fx,DFx,lb,ub,lambda1,lambda2,n,Indexset)
|
2014-05-18 21:49:16 +02:00
|
|
|
%% DPHI evaluates an element of the C-subdifferential of operator Phi
|
2014-05-12 17:15:49 +02:00
|
|
|
|
|
|
|
null = 1e-8;
|
|
|
|
beta_l = zeros(n,1);
|
|
|
|
beta_u = zeros(n,1);
|
|
|
|
alpha_l = zeros(n,1);
|
|
|
|
alpha_u = zeros(n,1);
|
|
|
|
|
|
|
|
|
|
|
|
z = zeros(n,1);
|
|
|
|
H2 = sparse(n,n);
|
|
|
|
|
|
|
|
I = abs(x-lb)<=null & abs(Fx)<=null;
|
|
|
|
beta_l(I) = 1;
|
|
|
|
z(I) = 1;
|
|
|
|
|
|
|
|
I = abs(ub-x)<=null & abs(Fx)<=null;
|
|
|
|
beta_u(I) = 1;
|
|
|
|
z(I) = 1;
|
|
|
|
|
|
|
|
I = x-lb>=-null & Fx>=-null;
|
|
|
|
alpha_l(I) = 1;
|
|
|
|
|
|
|
|
I = ub-x>=-null & Fx<=null;
|
|
|
|
alpha_u(I) = 1;
|
|
|
|
|
|
|
|
Da = zeros(n,1);
|
|
|
|
Db = zeros(n,1);
|
|
|
|
|
|
|
|
I = 1:n;
|
|
|
|
|
|
|
|
I0 = Indexset==0;
|
|
|
|
Da(I0) = 0;
|
|
|
|
Db(I0) = -1;
|
|
|
|
H2(I0,:) = -DFx(I0,:);
|
|
|
|
|
|
|
|
I1 = Indexset==1;
|
|
|
|
denom1 = zeros(n,1);
|
|
|
|
denom2 = zeros(n,1);
|
|
|
|
if any(I1)
|
|
|
|
denom1(I1) = max(null,sqrt((x(I1)-lb(I1)).^2+Fx(I1).^2));
|
|
|
|
denom2(I1) = max(null,sqrt(z(I1).^2+(DFx(I1,:)*z).^2));
|
|
|
|
end
|
|
|
|
|
|
|
|
I1b = Indexset==1 & beta_l==0;
|
|
|
|
Da(I1b) = (x(I1b)-lb(I1b))./denom1(I1b)-1;
|
|
|
|
Db(I1b) = Fx(I1b)./denom1(I1b)-1;
|
|
|
|
I1b = Indexset==1 & beta_l~=0;
|
|
|
|
if any(I1b)
|
2014-05-18 21:49:16 +02:00
|
|
|
Da(I1b) = z(I1b)./denom2(I1b)-1;
|
|
|
|
Db(I1b) = (DFx(I1b,:)*z)./denom2(I1b)-1;
|
2014-05-12 17:15:49 +02:00
|
|
|
end
|
|
|
|
|
2014-05-18 21:49:16 +02:00
|
|
|
I1a = I(Indexset==1 & alpha_l==1);
|
2014-05-12 17:15:49 +02:00
|
|
|
if any(I1a)
|
2015-12-30 13:29:28 +01:00
|
|
|
H2(I1a,:) = spdiags(x(I1a)-lb(I1a), 0, length(I1a), length(I1a))*DFx(I1a,:) +...
|
2014-05-18 21:49:16 +02:00
|
|
|
sparse(1:length(I1a),I1a,Fx(I1a),length(I1a),n,length(I1a));
|
2014-05-12 17:15:49 +02:00
|
|
|
end
|
|
|
|
|
|
|
|
I2 = Indexset==2;
|
|
|
|
denom1 = zeros(n,1);
|
|
|
|
denom2 = zeros(n,1);
|
|
|
|
if any(I2)
|
|
|
|
denom1(I2) = max(null,sqrt((ub(I2)-x(I2)).^2+Fx(I2).^2));
|
|
|
|
denom2(I2) = max(null,sqrt(z(I2).^2+(DFx(I2,:)*z).^2));
|
|
|
|
end
|
|
|
|
|
|
|
|
I2b = Indexset==2 & beta_u==0;
|
|
|
|
Da(I2b) = (ub(I2b)-x(I2b))./denom1(I2b)-1;
|
|
|
|
Db(I2b) = -Fx(I2b)./denom1(I2b)-1;
|
|
|
|
I2b = Indexset==2 & beta_u~=0;
|
|
|
|
if any(I2b)
|
2014-05-18 21:49:16 +02:00
|
|
|
Da(I2b) = -z(I2b)./denom2(I2b)-1;
|
|
|
|
Db(I2b) = -(DFx(I2b,:)*z)./denom2(I2b)-1;
|
2014-05-12 17:15:49 +02:00
|
|
|
end
|
|
|
|
|
2014-05-18 21:49:16 +02:00
|
|
|
I2a = I(Indexset==2 & alpha_u==1);
|
2014-05-12 17:15:49 +02:00
|
|
|
if any(I2a)
|
2014-05-18 21:49:16 +02:00
|
|
|
H2(I2a,:) = bsxfun(@times,x(I2a)-ub(I2a),DFx(I2a,:))+...
|
|
|
|
sparse(1:length(I2a),I2a,Fx(I2a),length(I2a),n,length(I2a));
|
2014-05-12 17:15:49 +02:00
|
|
|
end
|
|
|
|
|
|
|
|
I3 = Indexset==3;
|
|
|
|
phi = zeros(n,1);
|
|
|
|
ai = zeros(n,1);
|
|
|
|
bi = zeros(n,1);
|
|
|
|
ci = zeros(n,1);
|
|
|
|
di = zeros(n,1);
|
|
|
|
denom1 = zeros(n,1);
|
|
|
|
denom2 = zeros(n,1);
|
|
|
|
denom3 = zeros(n,1);
|
|
|
|
denom4 = zeros(n,1);
|
|
|
|
if any(I3)
|
|
|
|
phi(I3) = -ub(I3)+x(I3)+Fx(I3)+sqrt((ub(I3)-x(I3)).^2+Fx(I3).^2);
|
|
|
|
denom1(I3) = max(null,sqrt((x(I3)-lb(I3)).^2+phi(I3).^2));
|
|
|
|
denom2(I3) = max(null,sqrt(z(I3).^2+(DFx(I3,:)*z).^2));
|
|
|
|
denom3(I3) = max(null,sqrt((ub(I3)-x(I3)).^2+Fx(I3).^2));
|
|
|
|
denom4(I3) = max(null,sqrt(z(I3).^2));
|
|
|
|
end
|
|
|
|
|
|
|
|
I3bu = Indexset==3 & beta_u==0;
|
|
|
|
ci(I3bu) = (x(I3bu)-ub(I3bu))./denom3(I3bu)+1;
|
|
|
|
di(I3bu) = Fx(I3bu)./denom3(I3bu)+1;
|
|
|
|
I3bu = Indexset==3 & beta_u~=0;
|
|
|
|
if any(I3bu)
|
|
|
|
ci(I3bu) = 1+z(I3bu)./denom2(I3bu);
|
|
|
|
di(I3bu) = 1+(DFx(I3bu,:)*z)./denom2(I3bu);
|
|
|
|
end
|
|
|
|
|
|
|
|
I3bl = Indexset==3 & beta_l==0;
|
|
|
|
ai(I3bl) = (x(I3bl)-lb(I3bl))./denom1(I3bl)-1;
|
|
|
|
bi(I3bl) = phi(I3bl)./denom1(I3bl)-1;
|
|
|
|
I3bl = Indexset==3 & beta_l~=0;
|
|
|
|
if any(I3bl)
|
|
|
|
ai(I3bl) = z(I3bl)./denom4(I3bl)-1;
|
|
|
|
bi(I3bl) = (ci(I3bl).*z(I3bl)+(di(I3bl,ones(1,n)).*DFx(I3bl,:))*z)./denom4(I3bl)-1;
|
|
|
|
end
|
|
|
|
|
|
|
|
Da(I3) = ai(I3)+bi(I3).*ci(I3);
|
|
|
|
Db(I3) = bi(I3).*di(I3);
|
|
|
|
|
2014-05-18 21:49:16 +02:00
|
|
|
I3a = I(Indexset==3 & alpha_l==1 & alpha_u==1);
|
2014-05-12 17:15:49 +02:00
|
|
|
if any(I3a)
|
2014-05-18 21:49:16 +02:00
|
|
|
H2(I3a,:) = bsxfun(@times,-lb(I3a)-ub(I3a)+2*x(I3a),DFx(I3a,:))+...
|
|
|
|
2*sparse(1:length(I3a),I3a,Fx(I3a),length(I3a),n,length(I3a));
|
2014-05-12 17:15:49 +02:00
|
|
|
end
|
2014-05-18 21:49:16 +02:00
|
|
|
I3a = I(Indexset==3 & alpha_l==1 & alpha_u~=1);
|
2014-05-12 17:15:49 +02:00
|
|
|
if any(I3a)
|
2014-05-18 21:49:16 +02:00
|
|
|
H2(I3a,:) = bsxfun(@times,x(I3a)-lb(I3a),DFx(I3a,:))+...
|
|
|
|
sparse(1:length(I3a),I3a,Fx(I3a),length(I3a),n,length(I3a));
|
2014-05-12 17:15:49 +02:00
|
|
|
end
|
2014-05-18 21:49:16 +02:00
|
|
|
I3a = I(Indexset==3 & alpha_l~=1 & alpha_u==1);
|
2014-05-12 17:15:49 +02:00
|
|
|
if any(I3a)
|
2014-05-18 21:49:16 +02:00
|
|
|
H2(I3a,:) = bsxfun(@times,x(I3a)-ub(I3a),DFx(I3a,:))+...
|
|
|
|
sparse(1:length(I3a),I3a,Fx(I3a),length(I3a),n,length(I3a));
|
2014-05-12 17:15:49 +02:00
|
|
|
end
|
|
|
|
|
2015-12-30 13:29:28 +01:00
|
|
|
H1 = spdiags(Db,0,length(Db),length(Db))*DFx;
|
|
|
|
H1 = H1 + spdiags(Da, 0, length(Da), length(Da));
|
2014-05-18 21:49:16 +02:00
|
|
|
|
|
|
|
H = [lambda1*H1; lambda2*H2];
|